C6H7Br3O2 — CID 172830306
cyclohexa-2,5-diene-1,4-dione;trihydrobromide (PubChem CID 172830306) has the molecular formula C6H7Br3O2 and a molecular weight of 350.83 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;trihydrobromide.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;trihydrobromide |
|---|---|
| PubChem CID | 172830306 |
| Molecular Formula | C6H7Br3O2 |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 347.80 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;trihydrobromide |
| SMILES | Br.Br.Br.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.3BrH/c7-5-1-2-6(8)4-3-5;;;/h1-4H;3*1H |
| InChIKey | VKSJDSGQNICBOR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|