About cyclohexa-2,5-diene-1,4-dione;triazine
cyclohexa-2,5-diene-1,4-dione;triazine (PubChem CID 160652744) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;triazine.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;triazine |
| PubChem CID | 160652744 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;triazine |
| SMILES | O=C1C=CC(=O)C=C1.c1cnnnc1 |
| InChI | InChI=1S/C6H4O2.C3H3N3/c7-5-1-2-6(8)4-3-5;1-2-4-6-5-3-1/h1-4H;1-3H |
| InChIKey | RKQDYUVLNSWMTA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;triazine?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;triazine (CID 160652744) is cyclohexa-2,5-diene-1,4-dione;triazine.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;triazine?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;triazine is O=C1C=CC(=O)C=C1.c1cnnnc1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;triazine?
The InChIKey is RKQDYUVLNSWMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C3H3N3/c7-5-1-2-6(8)4-3-5;1-2-4-6-5-3-1/h1-4H;1-3H.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;triazine?
cyclohexa-2,5-diene-1,4-dione;triazine has a molecular weight of 189.17 g/mol, XLogP of 0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;triazine is sourced from PubChem (CID 160652744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).