C8H10O2 — CID 91596056
cyclohexa-2,5-diene-1,4-dione;ethane (PubChem CID 91596056) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;ethane.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;ethane |
|---|---|
| PubChem CID | 91596056 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;ethane |
| SMILES | CC.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C2H6/c7-5-1-2-6(8)4-3-5;1-2/h1-4H;1-2H3 |
| InChIKey | SUWNVFFEBXKOOP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|