C14H21FO — CID 11447436
2,4-ditert-butyl-4-fluorocyclohexa-2,5-dien-1-one (PubChem CID 11447436) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is 2,4-ditert-butyl-4-fluorocyclohexa-2,5-dien-1-one.
| Compound Name | 2,4-ditert-butyl-4-fluorocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 11447436 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,4-ditert-butyl-4-fluorocyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(F)(C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C14H21FO/c1-12(2,3)10-9-14(15,13(4,5)6)8-7-11(10)16/h7-9H,1-6H3 |
| InChIKey | WDCHRXYOPQEGFC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |