C14H20Cl2O — CID 3761002
2,6-ditert-butyl-4,6-dichlorocyclohexa-2,4-dien-1-one (PubChem CID 3761002) has the molecular formula C14H20Cl2O and a molecular weight of 275.22 g/mol. Its IUPAC name is 2,6-ditert-butyl-4,6-dichlorocyclohexa-2,4-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4,6-dichlorocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 3761002 |
| Molecular Formula | C14H20Cl2O |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,6-ditert-butyl-4,6-dichlorocyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=CC(Cl)=CC(Cl)(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H20Cl2O/c1-12(2,3)10-7-9(15)8-14(16,11(10)17)13(4,5)6/h7-8H,1-6H3 |
| InChIKey | XHNPIDBRYKQNPQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|