About 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one
6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one (PubChem CID 141071783) has the molecular formula C12H10O3
and a molecular weight of 202.21 g/mol. Its IUPAC name is 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 141071783 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1(O)Oc1ccccc1 |
| InChI | InChI=1S/C12H10O3/c13-11-8-4-5-9-12(11,14)15-10-6-2-1-3-7-10/h1-9,14H |
| InChIKey | NNHURRAEPIRGGP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one (CID 141071783) is 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one is O=C1C=CC=CC1(O)Oc1ccccc1.
What is the InChIKey of 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one?
The InChIKey is NNHURRAEPIRGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3/c13-11-8-4-5-9-12(11,14)15-10-6-2-1-3-7-10/h1-9,14H.
What are the key properties of 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one?
6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one has a molecular weight of 202.21 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6-phenoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 141071783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).