About bismuthane;(3-phenoxydioxiran-3-yl)methanol
bismuthane;(3-phenoxydioxiran-3-yl)methanol (PubChem CID 174407046) has the molecular formula C8H11BiO4
and a molecular weight of 380.15 g/mol. Its IUPAC name is bismuthane;(3-phenoxydioxiran-3-yl)methanol.
Molecular Properties
| Compound Name | bismuthane;(3-phenoxydioxiran-3-yl)methanol |
| PubChem CID | 174407046 |
| Molecular Formula | C8H11BiO4 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | bismuthane;(3-phenoxydioxiran-3-yl)methanol |
| SMILES | OCC1(Oc2ccccc2)OO1.[BiH3] |
| InChI | InChI=1S/C8H8O4.Bi.3H/c9-6-8(11-12-8)10-7-4-2-1-3-5-7;;;;/h1-5,9H,6H2;;;; |
| InChIKey | ALZGCFNVQPFCLO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;(3-phenoxydioxiran-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;(3-phenoxydioxiran-3-yl)methanol?
The IUPAC name of bismuthane;(3-phenoxydioxiran-3-yl)methanol (CID 174407046) is bismuthane;(3-phenoxydioxiran-3-yl)methanol.
What is the SMILES notation for bismuthane;(3-phenoxydioxiran-3-yl)methanol?
The canonical SMILES for bismuthane;(3-phenoxydioxiran-3-yl)methanol is OCC1(Oc2ccccc2)OO1.[BiH3].
What is the InChIKey of bismuthane;(3-phenoxydioxiran-3-yl)methanol?
The InChIKey is ALZGCFNVQPFCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4.Bi.3H/c9-6-8(11-12-8)10-7-4-2-1-3-5-7;;;;/h1-5,9H,6H2;;;;.
What are the key properties of bismuthane;(3-phenoxydioxiran-3-yl)methanol?
bismuthane;(3-phenoxydioxiran-3-yl)methanol has a molecular weight of 380.15 g/mol, XLogP of -0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;(3-phenoxydioxiran-3-yl)methanol is sourced from PubChem (CID 174407046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).