C24H24N2O4S — CID 134362928
4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)sulfonyl-1-phenoxycyclohexa-2,4-dien-1-amine (PubChem CID 134362928) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)sulfonyl-1-phenoxycyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)sulfonyl-1-phenoxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134362928 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)sulfonyl-1-phenoxycyclohexa-2,4-dien-1-amine |
| SMILES | NC1(Oc2ccccc2)C=CC(S(=O)(=O)C2=CCC(N)(Oc3ccccc3)C=C2)=CC1 |
| InChI | InChI=1S/C24H24N2O4S/c25-23(29-19-7-3-1-4-8-19)15-11-21(12-16-23)31(27,28)22-13-17-24(26,18-14-22)30-20-9-5-2-6-10-20/h1-15,17H,16,18,25-26H2 |
| InChIKey | IOVBEPIHISFHNX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|