C18H18N2O — CID 152565245
4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)aniline (PubChem CID 152565245) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 152565245 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(4-amino-4-phenoxycyclohexa-1,5-dien-1-yl)aniline |
| SMILES | Nc1ccc(C2=CCC(N)(Oc3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C18H18N2O/c19-16-8-6-14(7-9-16)15-10-12-18(20,13-11-15)21-17-4-2-1-3-5-17/h1-12H,13,19-20H2 |
| InChIKey | YQIOYGJTCRJIKH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|