C19H22F2N2O8 — CID 161043876
4-[4-amino-4-(difluoromethoxy)cyclohexa-1,5-dien-1-yl]aniline;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 161043876) has the molecular formula C19H22F2N2O8 and a molecular weight of 444.39 g/mol. Its IUPAC name is 4-[4-amino-4-(difluoromethoxy)cyclohexa-1,5-dien-1-yl]aniline;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 4-[4-amino-4-(difluoromethoxy)cyclohexa-1,5-dien-1-yl]aniline;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 161043876 |
| Molecular Formula | C19H22F2N2O8 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-[4-amino-4-(difluoromethoxy)cyclohexa-1,5-dien-1-yl]aniline;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Nc1ccc(C2=CCC(N)(OC(F)F)C=C2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H14F2N2O.C6H8O7/c14-12(15)18-13(17)7-5-10(6-8-13)9-1-3-11(16)4-2-9;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-7,12H,8,16-17H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | UBFXYDRXNBMRHE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|