C18H18N2 — CID 97303996
4-[(4R)-4-amino-4-phenylcyclohexa-1,5-dien-1-yl]aniline (PubChem CID 97303996) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(4R)-4-amino-4-phenylcyclohexa-1,5-dien-1-yl]aniline.
| Compound Name | 4-[(4R)-4-amino-4-phenylcyclohexa-1,5-dien-1-yl]aniline |
|---|---|
| PubChem CID | 97303996 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(4R)-4-amino-4-phenylcyclohexa-1,5-dien-1-yl]aniline |
| SMILES | Nc1ccc(C2=CC[C@](N)(c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C18H18N2/c19-17-8-6-14(7-9-17)15-10-12-18(20,13-11-15)16-4-2-1-3-5-16/h1-12H,13,19-20H2/t18-/m0/s1 |
| InChIKey | QQWWWAQUMVHHQN-SFHVURJKSA-N |
| XLogP | 3.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|