C15H16N4O — CID 174734010
4-phenylcyclohexa-1,5-diene-1,4-diamine;pyrazol-3-one (PubChem CID 174734010) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-phenylcyclohexa-1,5-diene-1,4-diamine;pyrazol-3-one.
| Compound Name | 4-phenylcyclohexa-1,5-diene-1,4-diamine;pyrazol-3-one |
|---|---|
| PubChem CID | 174734010 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-phenylcyclohexa-1,5-diene-1,4-diamine;pyrazol-3-one |
| SMILES | NC1=CCC(N)(c2ccccc2)C=C1.O=C1C=CN=N1 |
| InChI | InChI=1S/C12H14N2.C3H2N2O/c13-11-6-8-12(14,9-7-11)10-4-2-1-3-5-10;6-3-1-2-4-5-3/h1-8H,9,13-14H2;1-2H |
| InChIKey | BFEBEEPKBKNPQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |