C12H14N2O3S — CID 141464042
2,5-diamino-5-phenylcyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 141464042) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2,5-diamino-5-phenylcyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 2,5-diamino-5-phenylcyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 141464042 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2,5-diamino-5-phenylcyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | NC1=C(S(=O)(=O)O)CC(N)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H14N2O3S/c13-10-6-7-12(14,8-11(10)18(15,16)17)9-4-2-1-3-5-9/h1-7H,8,13-14H2,(H,15,16,17) |
| InChIKey | CYKOWMJHWORWOY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|