C44H38N12O3S — CID 142902806
5,5-bis[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 142902806) has the molecular formula C44H38N12O3S and a molecular weight of 814.94 g/mol. Its IUPAC name is 5,5-bis[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 5,5-bis[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 142902806 |
| Molecular Formula | C44H38N12O3S |
| Molecular Weight | 814.94 g/mol |
| Exact Mass | 814.29 |
| IUPAC Name | 5,5-bis[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1=C(C=Cc2ccccc2)C=CC(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)C1 |
| InChI | InChI=1S/C44H38N12O3S/c57-60(58,59)37-30-44(29-28-32(37)27-26-31-16-6-1-7-17-31,55-42-51-38(45-33-18-8-2-9-19-33)49-39(52-42)46-34-20-10-3-11-21-34)56-43-53-40(47-35-22-12-4-13-23-35)50-41(54-43)48-36-24-14-5-15-25-36/h1-29H,30H2,(H,57,58,59)(H3,45,46,49,51,52,55)(H3,47,48,50,53,54,56) |
| InChIKey | ZWANYAGSMPAAOP-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 203.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.94 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|