C12H10BrCl — CID 67981012
5-bromo-2-chloro-5-phenylcyclohexa-1,3-diene (PubChem CID 67981012) has the molecular formula C12H10BrCl and a molecular weight of 269.57 g/mol. Its IUPAC name is 5-bromo-2-chloro-5-phenylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-2-chloro-5-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67981012 |
| Molecular Formula | C12H10BrCl |
| Molecular Weight | 269.57 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 5-bromo-2-chloro-5-phenylcyclohexa-1,3-diene |
| SMILES | ClC1=CCC(Br)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H10BrCl/c13-12(8-6-11(14)7-9-12)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | AJXZOSYQRPWJOG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|