C13H12ClN — CID 163807139
4-chloro-1-phenylcyclohepta-2,4,6-trien-1-amine (PubChem CID 163807139) has the molecular formula C13H12ClN and a molecular weight of 217.70 g/mol. Its IUPAC name is 4-chloro-1-phenylcyclohepta-2,4,6-trien-1-amine.
| Compound Name | 4-chloro-1-phenylcyclohepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 163807139 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-chloro-1-phenylcyclohepta-2,4,6-trien-1-amine |
| SMILES | NC1(c2ccccc2)C=CC=C(Cl)C=C1 |
| InChI | InChI=1S/C13H12ClN/c14-12-7-4-9-13(15,10-8-12)11-5-2-1-3-6-11/h1-10H,15H2 |
| InChIKey | NJZJMXPQGUVDLK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |