C49H40N4 — CID 101058768
2,2',7,7'-tetraphenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (PubChem CID 101058768) has the molecular formula C49H40N4 and a molecular weight of 684.89 g/mol. Its IUPAC name is 2,2',7,7'-tetraphenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine.
| Compound Name | 2,2',7,7'-tetraphenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 101058768 |
| Molecular Formula | C49H40N4 |
| Molecular Weight | 684.89 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 2,2',7,7'-tetraphenyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| SMILES | NC1(c2ccccc2)C=CC2=C3C=CC(N)(c4ccccc4)C=C3C3(C2=C1)C1=CC(N)(c2ccccc2)C=CC1=C1C=CC(N)(c2ccccc2)C=C13 |
| InChI | InChI=1S/C49H40N4/c50-45(33-13-5-1-6-14-33)25-21-37-38-22-26-46(51,34-15-7-2-8-16-34)30-42(38)49(41(37)29-45)43-31-47(52,35-17-9-3-10-18-35)27-23-39(43)40-24-28-48(53,32-44(40)49)36-19-11-4-12-20-36/h1-32H,50-53H2 |
| InChIKey | QFQMCSGXAPWYKZ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.89 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |