C20H27NO — CID 141114191
4-amino-2,6-ditert-butyl-4-phenylcyclohexa-2,5-dien-1-one (PubChem CID 141114191) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-amino-2,6-ditert-butyl-4-phenylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-amino-2,6-ditert-butyl-4-phenylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 141114191 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-amino-2,6-ditert-butyl-4-phenylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(N)(c2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C20H27NO/c1-18(2,3)15-12-20(21,14-10-8-7-9-11-14)13-16(17(15)22)19(4,5)6/h7-13H,21H2,1-6H3 |
| InChIKey | ALOSNESOPYXWHK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |