C42H62O3 — CID 15269405
2,6-ditert-butyl-4,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)cyclohexa-2,5-dien-1-one (PubChem CID 15269405) has the molecular formula C42H62O3 and a molecular weight of 614.96 g/mol. Its IUPAC name is 2,6-ditert-butyl-4,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15269405 |
| Molecular Formula | C42H62O3 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | 2,6-ditert-butyl-4,4-bis(3,5-ditert-butyl-4-hydroxyphenyl)cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C42H62O3/c1-36(2,3)27-19-25(20-28(33(27)43)37(4,5)6)42(23-31(40(13,14)15)35(45)32(24-42)41(16,17)18)26-21-29(38(7,8)9)34(44)30(22-26)39(10,11)12/h19-24,43-44H,1-18H3 |
| InChIKey | DPBVWPRFGYSVTL-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |