C38H56O4 — CID 15535451
2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)adamantane-2,6-diol (PubChem CID 15535451) has the molecular formula C38H56O4 and a molecular weight of 576.86 g/mol. Its IUPAC name is 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)adamantane-2,6-diol.
| Compound Name | 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)adamantane-2,6-diol |
|---|---|
| PubChem CID | 15535451 |
| Molecular Formula | C38H56O4 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.42 |
| IUPAC Name | 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)adamantane-2,6-diol |
| SMILES | CC(C)(C)c1cc(C2(O)C3CC4CC2CC(C3)C4(O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C38H56O4/c1-33(2,3)27-17-25(18-28(31(27)39)34(4,5)6)37(41)21-13-23-15-22(37)16-24(14-21)38(23,42)26-19-29(35(7,8)9)32(40)30(20-26)36(10,11)12/h17-24,39-42H,13-16H2,1-12H3 |
| InChIKey | LGVZUCSXWJZATI-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |