C20H26O3S — CID 18352046
4-(benzenesulfonyl)-2,6-ditert-butylphenol (PubChem CID 18352046) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(benzenesulfonyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 18352046 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-(benzenesulfonyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H26O3S/c1-19(2,3)16-12-15(13-17(18(16)21)20(4,5)6)24(22,23)14-10-8-7-9-11-14/h7-13,21H,1-6H3 |
| InChIKey | HQTVVCSNZXOXSB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |