C14H14O4S — CID 101301695
5-(benzenesulfonyl)-2,4-dimethylbenzene-1,3-diol (PubChem CID 101301695) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2,4-dimethylbenzene-1,3-diol.
| Compound Name | 5-(benzenesulfonyl)-2,4-dimethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 101301695 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-(benzenesulfonyl)-2,4-dimethylbenzene-1,3-diol |
| SMILES | Cc1c(O)cc(S(=O)(=O)c2ccccc2)c(C)c1O |
| InChI | InChI=1S/C14H14O4S/c1-9-12(15)8-13(10(2)14(9)16)19(17,18)11-6-4-3-5-7-11/h3-8,15-16H,1-2H3 |
| InChIKey | ZJPMEYYQRZWFBM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |