C39H40O3P2 — CID 15093577
4-[bis(diphenylphosphoryl)methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one (PubChem CID 15093577) has the molecular formula C39H40O3P2 and a molecular weight of 618.69 g/mol. Its IUPAC name is 4-[bis(diphenylphosphoryl)methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[bis(diphenylphosphoryl)methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15093577 |
| Molecular Formula | C39H40O3P2 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 4-[bis(diphenylphosphoryl)methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=C(P(=O)(c2ccccc2)c2ccccc2)P(=O)(c2ccccc2)c2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C39H40O3P2/c1-38(2,3)34-27-29(28-35(36(34)40)39(4,5)6)37(43(41,30-19-11-7-12-20-30)31-21-13-8-14-22-31)44(42,32-23-15-9-16-24-32)33-25-17-10-18-26-33/h7-28H,1-6H3 |
| InChIKey | KFDPYAVKRQGRFS-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|