C30H32N2OS — CID 142980839
2,6-ditert-butyl-4-[(3-methyl-2-benzothiophen-1-yl)-phenyldiazenylmethylidene]cyclohexa-2,5-dien-1-one (PubChem CID 142980839) has the molecular formula C30H32N2OS and a molecular weight of 468.67 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3-methyl-2-benzothiophen-1-yl)-phenyldiazenylmethylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(3-methyl-2-benzothiophen-1-yl)-phenyldiazenylmethylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142980839 |
| Molecular Formula | C30H32N2OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3-methyl-2-benzothiophen-1-yl)-phenyldiazenylmethylidene]cyclohexa-2,5-dien-1-one |
| SMILES | Cc1sc(C(/N=N/c2ccccc2)=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2ccccc12 |
| InChI | InChI=1S/C30H32N2OS/c1-19-22-15-11-12-16-23(22)28(34-19)26(32-31-21-13-9-8-10-14-21)20-17-24(29(2,3)4)27(33)25(18-20)30(5,6)7/h8-18H,1-7H3/b32-31+ |
| InChIKey | RGFJMYOMRVEBGF-QNEJGDQOSA-N |
| XLogP | 9.23 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|