C18H17N — CID 141027674
1,2-diphenylcyclohexa-2,4-dien-1-amine (PubChem CID 141027674) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 1,2-diphenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1,2-diphenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 141027674 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1,2-diphenylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1(c2ccccc2)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C18H17N/c19-18(16-11-5-2-6-12-16)14-8-7-13-17(18)15-9-3-1-4-10-15/h1-13H,14,19H2 |
| InChIKey | ZUZSTMCEMWIPFF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |