About 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene
6,6-diisocyanato-1-phenylcyclohexa-1,3-diene (PubChem CID 87061261) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene |
| PubChem CID | 87061261 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene |
| SMILES | O=C=NC1(N=C=O)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C14H10N2O2/c17-10-15-14(16-11-18)9-5-4-8-13(14)12-6-2-1-3-7-12/h1-8H,9H2 |
| InChIKey | TYWBUUHQELORRT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene?
The IUPAC name of 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene (CID 87061261) is 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene?
The canonical SMILES for 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene is O=C=NC1(N=C=O)CC=CC=C1c1ccccc1.
What is the InChIKey of 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene?
The InChIKey is TYWBUUHQELORRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-10-15-14(16-11-18)9-5-4-8-13(14)12-6-2-1-3-7-12/h1-8H,9H2.
What are the key properties of 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene?
6,6-diisocyanato-1-phenylcyclohexa-1,3-diene has a molecular weight of 238.25 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diisocyanato-1-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 87061261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).