C19H16FNO2 — CID 175556672
N-(1-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)-N-hydroxybenzamide (PubChem CID 175556672) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is N-(1-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)-N-hydroxybenzamide.
| Compound Name | N-(1-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)-N-hydroxybenzamide |
|---|---|
| PubChem CID | 175556672 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(1-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)-N-hydroxybenzamide |
| SMILES | O=C(c1ccccc1)N(O)C1(F)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C19H16FNO2/c20-19(21(23)18(22)16-11-5-2-6-12-16)14-8-7-13-17(19)15-9-3-1-4-10-15/h1-13,23H,14H2 |
| InChIKey | JVMSLJJTNNBDFB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|