C15H16O4 — CID 174779093
ethyl (1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl) carbonate (PubChem CID 174779093) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl (1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl) carbonate.
| Compound Name | ethyl (1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl) carbonate |
|---|---|
| PubChem CID | 174779093 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | ethyl (1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl) carbonate |
| SMILES | CCOC(=O)OC1(O)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C15H16O4/c1-2-18-14(16)19-15(17)11-7-6-10-13(15)12-8-4-3-5-9-12/h3-10,17H,2,11H2,1H3 |
| InChIKey | NOPMXCPYGZVLOK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|