About ethyl (1-methylcyclopropyl) carbonate
ethyl (1-methylcyclopropyl) carbonate (PubChem CID 89090966) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is ethyl (1-methylcyclopropyl) carbonate.
Molecular Properties
| Compound Name | ethyl (1-methylcyclopropyl) carbonate |
| PubChem CID | 89090966 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | ethyl (1-methylcyclopropyl) carbonate |
| SMILES | CCOC(=O)OC1(C)CC1 |
| InChI | InChI=1S/C7H12O3/c1-3-9-6(8)10-7(2)4-5-7/h3-5H2,1-2H3 |
| InChIKey | SZXUVOXIUIDMRJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (1-methylcyclopropyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1-methylcyclopropyl) carbonate?
The IUPAC name of ethyl (1-methylcyclopropyl) carbonate (CID 89090966) is ethyl (1-methylcyclopropyl) carbonate.
What is the SMILES notation for ethyl (1-methylcyclopropyl) carbonate?
The canonical SMILES for ethyl (1-methylcyclopropyl) carbonate is CCOC(=O)OC1(C)CC1.
What is the InChIKey of ethyl (1-methylcyclopropyl) carbonate?
The InChIKey is SZXUVOXIUIDMRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-9-6(8)10-7(2)4-5-7/h3-5H2,1-2H3.
What are the key properties of ethyl (1-methylcyclopropyl) carbonate?
ethyl (1-methylcyclopropyl) carbonate has a molecular weight of 144.17 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1-methylcyclopropyl) carbonate is sourced from PubChem (CID 89090966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).