C26H40O4 — CID 70488625
[4-[4-(4-butoxyphenyl)cyclohexyl]-1-methylcyclohexyl] ethyl carbonate (PubChem CID 70488625) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [4-[4-(4-butoxyphenyl)cyclohexyl]-1-methylcyclohexyl] ethyl carbonate.
| Compound Name | [4-[4-(4-butoxyphenyl)cyclohexyl]-1-methylcyclohexyl] ethyl carbonate |
|---|---|
| PubChem CID | 70488625 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [4-[4-(4-butoxyphenyl)cyclohexyl]-1-methylcyclohexyl] ethyl carbonate |
| SMILES | CCCCOc1ccc(C2CCC(C3CCC(C)(OC(=O)OCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H40O4/c1-4-6-19-29-24-13-11-22(12-14-24)20-7-9-21(10-8-20)23-15-17-26(3,18-16-23)30-25(27)28-5-2/h11-14,20-21,23H,4-10,15-19H2,1-3H3 |
| InChIKey | XPYAHWNODLOLPN-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|