C34H55NO2 — CID 134486536
4-[4-[4-(4-butoxyphenyl)cyclohexyl]cyclohexyl]-2,2,6,6-tetramethyl-1-[(E)-prop-1-enoxy]piperidine (PubChem CID 134486536) has the molecular formula C34H55NO2 and a molecular weight of 509.82 g/mol. Its IUPAC name is 4-[4-[4-(4-butoxyphenyl)cyclohexyl]cyclohexyl]-2,2,6,6-tetramethyl-1-[(E)-prop-1-enoxy]piperidine.
| Compound Name | 4-[4-[4-(4-butoxyphenyl)cyclohexyl]cyclohexyl]-2,2,6,6-tetramethyl-1-[(E)-prop-1-enoxy]piperidine |
|---|---|
| PubChem CID | 134486536 |
| Molecular Formula | C34H55NO2 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | 4-[4-[4-(4-butoxyphenyl)cyclohexyl]cyclohexyl]-2,2,6,6-tetramethyl-1-[(E)-prop-1-enoxy]piperidine |
| SMILES | C/C=C/ON1C(C)(C)CC(C2CCC(C3CCC(c4ccc(OCCCC)cc4)CC3)CC2)CC1(C)C |
| InChI | InChI=1S/C34H55NO2/c1-7-9-23-36-32-20-18-29(19-21-32)28-12-10-26(11-13-28)27-14-16-30(17-15-27)31-24-33(3,4)35(37-22-8-2)34(5,6)25-31/h8,18-22,26-28,30-31H,7,9-17,23-25H2,1-6H3/b22-8+ |
| InChIKey | GVOBMLWXUOFWAH-GZIVZEMBSA-N |
| XLogP | 9.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|