C38H63NO — CID 134486545
4-[4-[4-(4-but-3-enylphenyl)cyclohexyl]cyclohexyl]-1-heptoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 134486545) has the molecular formula C38H63NO and a molecular weight of 549.93 g/mol. Its IUPAC name is 4-[4-[4-(4-but-3-enylphenyl)cyclohexyl]cyclohexyl]-1-heptoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[4-[4-(4-but-3-enylphenyl)cyclohexyl]cyclohexyl]-1-heptoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486545 |
| Molecular Formula | C38H63NO |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 549.49 |
| IUPAC Name | 4-[4-[4-(4-but-3-enylphenyl)cyclohexyl]cyclohexyl]-1-heptoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCCc1ccc(C2CCC(C3CCC(C4CC(C)(C)N(OCCCCCCC)C(C)(C)C4)CC3)CC2)cc1 |
| InChI | InChI=1S/C38H63NO/c1-7-9-11-12-13-27-40-39-37(3,4)28-36(29-38(39,5)6)35-25-23-34(24-26-35)33-21-19-32(20-22-33)31-17-15-30(16-18-31)14-10-8-2/h8,15-18,32-36H,2,7,9-14,19-29H2,1,3-6H3 |
| InChIKey | OFEDTKJIKQAVPB-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|