C31H41NO — CID 134486617
1-ethenoxy-2,2,6,6-tetramethyl-4-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]piperidine (PubChem CID 134486617) has the molecular formula C31H41NO and a molecular weight of 443.68 g/mol. Its IUPAC name is 1-ethenoxy-2,2,6,6-tetramethyl-4-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]piperidine.
| Compound Name | 1-ethenoxy-2,2,6,6-tetramethyl-4-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 134486617 |
| Molecular Formula | C31H41NO |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | 1-ethenoxy-2,2,6,6-tetramethyl-4-[4-[4-[(3E)-octa-3,7-dienyl]phenyl]phenyl]piperidine |
| SMILES | C=CCC/C=C/CCc1ccc(-c2ccc(C3CC(C)(C)N(OC=C)C(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C31H41NO/c1-7-9-10-11-12-13-14-25-15-17-26(18-16-25)27-19-21-28(22-20-27)29-23-30(3,4)32(33-8-2)31(5,6)24-29/h7-8,11-12,15-22,29H,1-2,9-10,13-14,23-24H2,3-6H3/b12-11+ |
| InChIKey | SVIUYFYODXBPAI-VAWYXSNFSA-N |
| XLogP | 8.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|