C19H19F — CID 72568917
1-fluoro-4-(4-hepta-3,6-dienylphenyl)benzene (PubChem CID 72568917) has the molecular formula C19H19F and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-fluoro-4-(4-hepta-3,6-dienylphenyl)benzene.
| Compound Name | 1-fluoro-4-(4-hepta-3,6-dienylphenyl)benzene |
|---|---|
| PubChem CID | 72568917 |
| Molecular Formula | C19H19F |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-fluoro-4-(4-hepta-3,6-dienylphenyl)benzene |
| SMILES | C=CCC=CCCc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19F/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(20)15-13-18/h2,4-5,8-15H,1,3,6-7H2 |
| InChIKey | RCAAHFAVPPWCOH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|