About 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde
1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde (PubChem CID 175463820) has the molecular formula C13H10F2O
and a molecular weight of 220.22 g/mol. Its IUPAC name is 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde.
Molecular Properties
| Compound Name | 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde |
| PubChem CID | 175463820 |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde |
| SMILES | C=O.Fc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C12H8F2.CH2O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h1-8H;1H2 |
| InChIKey | XSLVDLOWSNCSKC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde?
The IUPAC name of 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde (CID 175463820) is 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde.
What is the SMILES notation for 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde?
The canonical SMILES for 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde is C=O.Fc1ccc(-c2ccc(F)cc2)cc1.
What is the InChIKey of 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde?
The InChIKey is XSLVDLOWSNCSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2.CH2O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h1-8H;1H2.
What are the key properties of 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde?
1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde has a molecular weight of 220.22 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(4-fluorophenyl)benzene;formaldehyde is sourced from PubChem (CID 175463820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).