C19H28O — CID 20676986
1-butoxy-4-(4-prop-2-enylcyclohexyl)benzene (PubChem CID 20676986) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-butoxy-4-(4-prop-2-enylcyclohexyl)benzene.
| Compound Name | 1-butoxy-4-(4-prop-2-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 20676986 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-butoxy-4-(4-prop-2-enylcyclohexyl)benzene |
| SMILES | C=CCC1CCC(c2ccc(OCCCC)cc2)CC1 |
| InChI | InChI=1S/C19H28O/c1-3-5-15-20-19-13-11-18(12-14-19)17-9-7-16(6-4-2)8-10-17/h4,11-14,16-17H,2-3,5-10,15H2,1H3 |
| InChIKey | DDEVKINIWAMDHJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|