C11H7F3O2 — CID 12635516
1,4,4-trifluoro-2-phenylcyclobut-2-ene-1-carboxylic acid (PubChem CID 12635516) has the molecular formula C11H7F3O2 and a molecular weight of 228.17 g/mol. Its IUPAC name is 1,4,4-trifluoro-2-phenylcyclobut-2-ene-1-carboxylic acid.
| Compound Name | 1,4,4-trifluoro-2-phenylcyclobut-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 12635516 |
| Molecular Formula | C11H7F3O2 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1,4,4-trifluoro-2-phenylcyclobut-2-ene-1-carboxylic acid |
| SMILES | O=C(O)C1(F)C(c2ccccc2)=CC1(F)F |
| InChI | InChI=1S/C11H7F3O2/c12-10(13)6-8(11(10,14)9(15)16)7-4-2-1-3-5-7/h1-6H,(H,15,16) |
| InChIKey | UYOQGKCDMLYHRX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |