About 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid
1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 174759391) has the molecular formula C13H12O4
and a molecular weight of 232.24 g/mol. Its IUPAC name is 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid.
Analyze 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 174759391) is 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1(O)CC(O)=CC=C1c1ccccc1.
What is the InChIKey of 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is BNSLVSDMUOLUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4/c14-10-6-7-11(9-4-2-1-3-5-9)13(17,8-10)12(15)16/h1-7,14,17H,8H2,(H,15,16).
What are the key properties of 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid?
1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.73, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroxy-2-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 174759391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).