C13H12O3 — CID 18380076
(1,5-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 18380076) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (1,5-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone.
| Compound Name | (1,5-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 18380076 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1,5-dihydroxycyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C13H12O3/c14-11-7-4-8-13(16,9-11)12(15)10-5-2-1-3-6-10/h1-8,14,16H,9H2 |
| InChIKey | HNLQCQVRTQXWDX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |