About 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate
1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate (PubChem CID 88824641) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate.
Molecular Properties
| Compound Name | 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate |
| PubChem CID | 88824641 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate |
| SMILES | O.O=CC1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C7H8O3.H2O/c8-5-7(10)3-1-2-6(9)4-7;/h1-3,5,9-10H,4H2;1H2 |
| InChIKey | XACJKIUEJZESKT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate?
The IUPAC name of 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate (CID 88824641) is 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate.
What is the SMILES notation for 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate?
The canonical SMILES for 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate is O.O=CC1(O)C=CC=C(O)C1.
What is the InChIKey of 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate?
The InChIKey is XACJKIUEJZESKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.H2O/c8-5-7(10)3-1-2-6(9)4-7;/h1-3,5,9-10H,4H2;1H2.
What are the key properties of 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate?
1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate has a molecular weight of 158.15 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde;hydrate is sourced from PubChem (CID 88824641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).