About (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone
(1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 150290031) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone |
| PubChem CID | 150290031 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | CC1=CC=CC(O)(C(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C15H16O2/c1-11-7-6-10-15(17,12(11)2)14(16)13-8-4-3-5-9-13/h3-10,12,17H,1-2H3 |
| InChIKey | GHJXLPSSJVKUAJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone?
The IUPAC name of (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone (CID 150290031) is (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone.
What is the SMILES notation for (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone?
The canonical SMILES for (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone is CC1=CC=CC(O)(C(=O)c2ccccc2)C1C.
What is the InChIKey of (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone?
The InChIKey is GHJXLPSSJVKUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-11-7-6-10-15(17,12(11)2)14(16)13-8-4-3-5-9-13/h3-10,12,17H,1-2H3.
What are the key properties of (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone?
(1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone has a molecular weight of 228.29 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-5,6-dimethylcyclohexa-2,4-dien-1-yl)-phenylmethanone is sourced from PubChem (CID 150290031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).