C14H18OSi — CID 173418091
1,5-dimethyl-6-phenylsilylcyclohexa-2,4-dien-1-ol (PubChem CID 173418091) has the molecular formula C14H18OSi and a molecular weight of 230.38 g/mol. Its IUPAC name is 1,5-dimethyl-6-phenylsilylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1,5-dimethyl-6-phenylsilylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 173418091 |
| Molecular Formula | C14H18OSi |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,5-dimethyl-6-phenylsilylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CC=CC(C)(O)C1[SiH2]c1ccccc1 |
| InChI | InChI=1S/C14H18OSi/c1-11-7-6-10-14(2,15)13(11)16-12-8-4-3-5-9-12/h3-10,13,15H,16H2,1-2H3 |
| InChIKey | NKAQFNANJMVRFR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|