C13H16Si — CID 174668523
(2,4-dimethylcyclopenta-2,4-dien-1-yl)-phenylsilane (PubChem CID 174668523) has the molecular formula C13H16Si and a molecular weight of 200.36 g/mol. Its IUPAC name is (2,4-dimethylcyclopenta-2,4-dien-1-yl)-phenylsilane.
| Compound Name | (2,4-dimethylcyclopenta-2,4-dien-1-yl)-phenylsilane |
|---|---|
| PubChem CID | 174668523 |
| Molecular Formula | C13H16Si |
| Molecular Weight | 200.36 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2,4-dimethylcyclopenta-2,4-dien-1-yl)-phenylsilane |
| SMILES | CC1=CC([SiH2]c2ccccc2)C(C)=C1 |
| InChI | InChI=1S/C13H16Si/c1-10-8-11(2)13(9-10)14-12-6-4-3-5-7-12/h3-9,13H,14H2,1-2H3 |
| InChIKey | NGLCLCMAFMFJSB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|