About diphenylsilane;hydrofluoride
diphenylsilane;hydrofluoride (PubChem CID 174486320) has the molecular formula C12H13FSi
and a molecular weight of 204.32 g/mol. Its IUPAC name is diphenylsilane;hydrofluoride.
Molecular Properties
| Compound Name | diphenylsilane;hydrofluoride |
| PubChem CID | 174486320 |
| Molecular Formula | C12H13FSi |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | diphenylsilane;hydrofluoride |
| SMILES | F.c1ccc([SiH2]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12Si.FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H,13H2;1H |
| InChIKey | CCHMJNFZKVUZKW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenylsilane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylsilane;hydrofluoride?
The IUPAC name of diphenylsilane;hydrofluoride (CID 174486320) is diphenylsilane;hydrofluoride.
What is the SMILES notation for diphenylsilane;hydrofluoride?
The canonical SMILES for diphenylsilane;hydrofluoride is F.c1ccc([SiH2]c2ccccc2)cc1.
What is the InChIKey of diphenylsilane;hydrofluoride?
The InChIKey is CCHMJNFZKVUZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Si.FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H,13H2;1H.
What are the key properties of diphenylsilane;hydrofluoride?
diphenylsilane;hydrofluoride has a molecular weight of 204.32 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylsilane;hydrofluoride is sourced from PubChem (CID 174486320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).