C12H22 — CID 142929908
ethane;1,3,5,6-tetramethylcyclohexa-1,3-diene (PubChem CID 142929908) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is ethane;1,3,5,6-tetramethylcyclohexa-1,3-diene.
| Compound Name | ethane;1,3,5,6-tetramethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142929908 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | ethane;1,3,5,6-tetramethylcyclohexa-1,3-diene |
| SMILES | CC.CC1=CC(C)C(C)C(C)=C1 |
| InChI | InChI=1S/C10H16.C2H6/c1-7-5-8(2)10(4)9(3)6-7;1-2/h5-6,8,10H,1-4H3;1-2H3 |
| InChIKey | BXBOMGPZUNBHGM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |