C8H10S — CID 151758145
2,4-dimethyl-7-thiabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 151758145) has the molecular formula C8H10S and a molecular weight of 138.23 g/mol. Its IUPAC name is 2,4-dimethyl-7-thiabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 2,4-dimethyl-7-thiabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 151758145 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 2,4-dimethyl-7-thiabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1=CC2SC2C(C)=C1 |
| InChI | InChI=1S/C8H10S/c1-5-3-6(2)8-7(4-5)9-8/h3-4,7-8H,1-2H3 |
| InChIKey | RPZCEONHTNBBKY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|