C8H12S — CID 134945502
4-ethenyl-2-methyl-3,6-dihydro-2H-thiopyran (PubChem CID 134945502) has the molecular formula C8H12S and a molecular weight of 140.25 g/mol. Its IUPAC name is 4-ethenyl-2-methyl-3,6-dihydro-2H-thiopyran.
| Compound Name | 4-ethenyl-2-methyl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 134945502 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 4-ethenyl-2-methyl-3,6-dihydro-2H-thiopyran |
| SMILES | C=CC1=CCSC(C)C1 |
| InChI | InChI=1S/C8H12S/c1-3-8-4-5-9-7(2)6-8/h3-4,7H,1,5-6H2,2H3 |
| InChIKey | XXSPCDFQILZCFM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |