C11H20S — CID 21034835
(3E)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene (PubChem CID 21034835) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is (3E)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene.
| Compound Name | (3E)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene |
|---|---|
| PubChem CID | 21034835 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (3E)-4-methyl-5-propan-2-ylsulfanylhepta-1,3-diene |
| SMILES | C=C/C=C(\C)C(CC)SC(C)C |
| InChI | InChI=1S/C11H20S/c1-6-8-10(5)11(7-2)12-9(3)4/h6,8-9,11H,1,7H2,2-5H3/b10-8+ |
| InChIKey | UQKVTVCSLBMSRW-CSKARUKUSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|