C20H28Si — CID 174668559
cyclohexyl-(2,4-dimethylcyclopenta-2,4-dien-1-yl)-methyl-phenylsilane (PubChem CID 174668559) has the molecular formula C20H28Si and a molecular weight of 296.53 g/mol. Its IUPAC name is cyclohexyl-(2,4-dimethylcyclopenta-2,4-dien-1-yl)-methyl-phenylsilane.
| Compound Name | cyclohexyl-(2,4-dimethylcyclopenta-2,4-dien-1-yl)-methyl-phenylsilane |
|---|---|
| PubChem CID | 174668559 |
| Molecular Formula | C20H28Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | cyclohexyl-(2,4-dimethylcyclopenta-2,4-dien-1-yl)-methyl-phenylsilane |
| SMILES | CC1=CC([Si](C)(c2ccccc2)C2CCCCC2)C(C)=C1 |
| InChI | InChI=1S/C20H28Si/c1-16-14-17(2)20(15-16)21(3,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4,6-7,10-11,14-15,19-20H,5,8-9,12-13H2,1-3H3 |
| InChIKey | GKXNMAFOPJJTAQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|