C10H13O2P — CID 175825539
phosphoroso-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)methanone (PubChem CID 175825539) has the molecular formula C10H13O2P and a molecular weight of 196.19 g/mol. Its IUPAC name is phosphoroso-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | phosphoroso-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 175825539 |
| Molecular Formula | C10H13O2P |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | phosphoroso-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)methanone |
| SMILES | CC1=CC=CC(C)(C)C1C(=O)P=O |
| InChI | InChI=1S/C10H13O2P/c1-7-5-4-6-10(2,3)8(7)9(11)13-12/h4-6,8H,1-3H3 |
| InChIKey | SGQNCCNVFVJRJX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|